C14H16O4 — CID 117373292
3-[1-(carboxymethyl)cyclopropyl]-4,5-dimethylbenzoic acid (PubChem CID 117373292) has the molecular formula C14H16O4 and a molecular weight of 248.28 g/mol. Its IUPAC name is 3-[1-(carboxymethyl)cyclopropyl]-4,5-dimethylbenzoic acid.
| Compound Name | 3-[1-(carboxymethyl)cyclopropyl]-4,5-dimethylbenzoic acid |
|---|---|
| PubChem CID | 117373292 |
| Molecular Formula | C14H16O4 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 3-[1-(carboxymethyl)cyclopropyl]-4,5-dimethylbenzoic acid |
| SMILES | Cc1cc(C(=O)O)cc(C2(CC(=O)O)CC2)c1C |
| InChI | InChI=1S/C14H16O4/c1-8-5-10(13(17)18)6-11(9(8)2)14(3-4-14)7-12(15)16/h5-6H,3-4,7H2,1-2H3,(H,15,16)(H,17,18) |
| InChIKey | GGJCRPXJUSQKAW-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |