C12H13ClO4S — CID 146681779
4-(2-chlorophenyl)-1,1-dioxothiane-4-carboxylic acid (PubChem CID 146681779) has the molecular formula C12H13ClO4S and a molecular weight of 288.75 g/mol. Its IUPAC name is 4-(2-chlorophenyl)-1,1-dioxothiane-4-carboxylic acid.
| Compound Name | 4-(2-chlorophenyl)-1,1-dioxothiane-4-carboxylic acid |
|---|---|
| PubChem CID | 146681779 |
| Molecular Formula | C12H13ClO4S |
| Molecular Weight | 288.75 g/mol |
| Exact Mass | 288.02 |
| IUPAC Name | 4-(2-chlorophenyl)-1,1-dioxothiane-4-carboxylic acid |
| SMILES | O=C(O)C1(c2ccccc2Cl)CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C12H13ClO4S/c13-10-4-2-1-3-9(10)12(11(14)15)5-7-18(16,17)8-6-12/h1-4H,5-8H2,(H,14,15) |
| InChIKey | QAXJGFMCHVJQCO-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.75 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |