C15H17ClO4 — CID 12595559
8-(2-chlorophenyl)-1,4-dioxaspiro[4.5]decane-8-carboxylic acid (PubChem CID 12595559) has the molecular formula C15H17ClO4 and a molecular weight of 296.75 g/mol. Its IUPAC name is 8-(2-chlorophenyl)-1,4-dioxaspiro[4.5]decane-8-carboxylic acid.
| Compound Name | 8-(2-chlorophenyl)-1,4-dioxaspiro[4.5]decane-8-carboxylic acid |
|---|---|
| PubChem CID | 12595559 |
| Molecular Formula | C15H17ClO4 |
| Molecular Weight | 296.75 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 8-(2-chlorophenyl)-1,4-dioxaspiro[4.5]decane-8-carboxylic acid |
| SMILES | O=C(O)C1(c2ccccc2Cl)CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C15H17ClO4/c16-12-4-2-1-3-11(12)14(13(17)18)5-7-15(8-6-14)19-9-10-20-15/h1-4H,5-10H2,(H,17,18) |
| InChIKey | DIJXQQRVMPMORF-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.75 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |