C12H13FO4S — CID 146681784
4-(3-fluorophenyl)-1,1-dioxothiane-4-carboxylic acid (PubChem CID 146681784) has the molecular formula C12H13FO4S and a molecular weight of 272.30 g/mol. Its IUPAC name is 4-(3-fluorophenyl)-1,1-dioxothiane-4-carboxylic acid.
| Compound Name | 4-(3-fluorophenyl)-1,1-dioxothiane-4-carboxylic acid |
|---|---|
| PubChem CID | 146681784 |
| Molecular Formula | C12H13FO4S |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | 4-(3-fluorophenyl)-1,1-dioxothiane-4-carboxylic acid |
| SMILES | O=C(O)C1(c2cccc(F)c2)CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C12H13FO4S/c13-10-3-1-2-9(8-10)12(11(14)15)4-6-18(16,17)7-5-12/h1-3,8H,4-7H2,(H,14,15) |
| InChIKey | WYSZLTMKNMPDOX-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |