C12H13IO2 — CID 117047003
1-(3-iodophenyl)cyclopentane-1-carboxylic acid (PubChem CID 117047003) has the molecular formula C12H13IO2 and a molecular weight of 316.14 g/mol. Its IUPAC name is 1-(3-iodophenyl)cyclopentane-1-carboxylic acid.
| Compound Name | 1-(3-iodophenyl)cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 117047003 |
| Molecular Formula | C12H13IO2 |
| Molecular Weight | 316.14 g/mol |
| Exact Mass | 316.00 |
| IUPAC Name | 1-(3-iodophenyl)cyclopentane-1-carboxylic acid |
| SMILES | O=C(O)C1(c2cccc(I)c2)CCCC1 |
| InChI | InChI=1S/C12H13IO2/c13-10-5-3-4-9(8-10)12(11(14)15)6-1-2-7-12/h3-5,8H,1-2,6-7H2,(H,14,15) |
| InChIKey | QIJWRSQAVSWKIT-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.14 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|