C13H16O4 — CID 117344540
1-(2,6-dihydroxyphenyl)cyclohexane-1-carboxylic acid (PubChem CID 117344540) has the molecular formula C13H16O4 and a molecular weight of 236.27 g/mol. Its IUPAC name is 1-(2,6-dihydroxyphenyl)cyclohexane-1-carboxylic acid.
| Compound Name | 1-(2,6-dihydroxyphenyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 117344540 |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 1-(2,6-dihydroxyphenyl)cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1(c2c(O)cccc2O)CCCCC1 |
| InChI | InChI=1S/C13H16O4/c14-9-5-4-6-10(15)11(9)13(12(16)17)7-2-1-3-8-13/h4-6,14-15H,1-3,7-8H2,(H,16,17) |
| InChIKey | AOSHVERAECGSJN-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |