C11H11BrO4 — CID 117462709
1-(6-bromo-2,3-dihydroxyphenyl)cyclobutane-1-carboxylic acid (PubChem CID 117462709) has the molecular formula C11H11BrO4 and a molecular weight of 287.11 g/mol. Its IUPAC name is 1-(6-bromo-2,3-dihydroxyphenyl)cyclobutane-1-carboxylic acid.
| Compound Name | 1-(6-bromo-2,3-dihydroxyphenyl)cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 117462709 |
| Molecular Formula | C11H11BrO4 |
| Molecular Weight | 287.11 g/mol |
| Exact Mass | 285.98 |
| IUPAC Name | 1-(6-bromo-2,3-dihydroxyphenyl)cyclobutane-1-carboxylic acid |
| SMILES | O=C(O)C1(c2c(Br)ccc(O)c2O)CCC1 |
| InChI | InChI=1S/C11H11BrO4/c12-6-2-3-7(13)9(14)8(6)11(10(15)16)4-1-5-11/h2-3,13-14H,1,4-5H2,(H,15,16) |
| InChIKey | CFTVNOAVXMOTCB-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.11 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|