C11H10BrFO4 — CID 117490227
1-(3-bromo-2-fluoro-5,6-dihydroxyphenyl)cyclobutane-1-carboxylic acid (PubChem CID 117490227) has the molecular formula C11H10BrFO4 and a molecular weight of 305.10 g/mol. Its IUPAC name is 1-(3-bromo-2-fluoro-5,6-dihydroxyphenyl)cyclobutane-1-carboxylic acid.
| Compound Name | 1-(3-bromo-2-fluoro-5,6-dihydroxyphenyl)cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 117490227 |
| Molecular Formula | C11H10BrFO4 |
| Molecular Weight | 305.10 g/mol |
| Exact Mass | 303.97 |
| IUPAC Name | 1-(3-bromo-2-fluoro-5,6-dihydroxyphenyl)cyclobutane-1-carboxylic acid |
| SMILES | O=C(O)C1(c2c(O)c(O)cc(Br)c2F)CCC1 |
| InChI | InChI=1S/C11H10BrFO4/c12-5-4-6(14)9(15)7(8(5)13)11(10(16)17)2-1-3-11/h4,14-15H,1-3H2,(H,16,17) |
| InChIKey | JDOUISQWRLOSER-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.10 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|