4-(1-carboxycyclobutyl)-3,5-difluorobenzoic acid

C12H10F2O4 — CID 117393397

IUPAC4-(1-carboxycyclobutyl)-3,5-difluorobenzoic acid
SMILESO=C(O)c1cc(F)c(C2(C(=O)O)CCC2)c(F)c1
InChIInChI=1S/C12H10F2O4/c13-7-4-6(10(15)16)5-8(14)9(7)12(11(17)18)2-1-3-12/h4-5H,1-3H2,(H,15,16)(H,17,18)
InChIKeyNVNIAFLGWFGLHW-UHFFFAOYSA-N
MW256.20 g/mol
LogP2.17
Rot. Bonds3

About 4-(1-carboxycyclobutyl)-3,5-difluorobenzoic acid

4-(1-carboxycyclobutyl)-3,5-difluorobenzoic acid (PubChem CID 117393397) has the molecular formula C12H10F2O4 and a molecular weight of 256.20 g/mol. Its IUPAC name is 4-(1-carboxycyclobutyl)-3,5-difluorobenzoic acid.

Molecular Properties

Compound Name4-(1-carboxycyclobutyl)-3,5-difluorobenzoic acid
PubChem CID117393397
Molecular FormulaC12H10F2O4
Molecular Weight256.20 g/mol
Exact Mass256.05
IUPAC Name4-(1-carboxycyclobutyl)-3,5-difluorobenzoic acid
SMILESO=C(O)c1cc(F)c(C2(C(=O)O)CCC2)c(F)c1
InChIInChI=1S/C12H10F2O4/c13-7-4-6(10(15)16)5-8(14)9(7)12(11(17)18)2-1-3-12/h4-5H,1-3H2,(H,15,16)(H,17,18)
InChIKeyNVNIAFLGWFGLHW-UHFFFAOYSA-N
XLogP2.17
TPSA74.60 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500256.20
LogP ≤ 52.17
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 4-(1-carboxycyclobutyl)-3,5-difluorobenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(1-carboxycyclobutyl)-3,5-difluorobenzoic acid?
The IUPAC name of 4-(1-carboxycyclobutyl)-3,5-difluorobenzoic acid (CID 117393397) is 4-(1-carboxycyclobutyl)-3,5-difluorobenzoic acid.
What is the SMILES notation for 4-(1-carboxycyclobutyl)-3,5-difluorobenzoic acid?
The canonical SMILES for 4-(1-carboxycyclobutyl)-3,5-difluorobenzoic acid is O=C(O)c1cc(F)c(C2(C(=O)O)CCC2)c(F)c1.
What is the InChIKey of 4-(1-carboxycyclobutyl)-3,5-difluorobenzoic acid?
The InChIKey is NVNIAFLGWFGLHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10F2O4/c13-7-4-6(10(15)16)5-8(14)9(7)12(11(17)18)2-1-3-12/h4-5H,1-3H2,(H,15,16)(H,17,18).
What are the key properties of 4-(1-carboxycyclobutyl)-3,5-difluorobenzoic acid?
4-(1-carboxycyclobutyl)-3,5-difluorobenzoic acid has a molecular weight of 256.20 g/mol, XLogP of 2.17, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1-carboxycyclobutyl)-3,5-difluorobenzoic acid is sourced from PubChem (CID 117393397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).