C11H9F3O3 — CID 117367168
1-(2,3,5-trifluoro-6-hydroxyphenyl)cyclobutane-1-carboxylic acid (PubChem CID 117367168) has the molecular formula C11H9F3O3 and a molecular weight of 246.18 g/mol. Its IUPAC name is 1-(2,3,5-trifluoro-6-hydroxyphenyl)cyclobutane-1-carboxylic acid.
| Compound Name | 1-(2,3,5-trifluoro-6-hydroxyphenyl)cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 117367168 |
| Molecular Formula | C11H9F3O3 |
| Molecular Weight | 246.18 g/mol |
| Exact Mass | 246.05 |
| IUPAC Name | 1-(2,3,5-trifluoro-6-hydroxyphenyl)cyclobutane-1-carboxylic acid |
| SMILES | O=C(O)C1(c2c(O)c(F)cc(F)c2F)CCC1 |
| InChI | InChI=1S/C11H9F3O3/c12-5-4-6(13)9(15)7(8(5)14)11(10(16)17)2-1-3-11/h4,15H,1-3H2,(H,16,17) |
| InChIKey | HIADPCKJPIYTCB-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.18 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|