C11H9BrF2O2 — CID 117469962
1-(3-bromo-2,6-difluoro-5-methylphenyl)cyclopropane-1-carboxylic acid (PubChem CID 117469962) has the molecular formula C11H9BrF2O2 and a molecular weight of 291.09 g/mol. Its IUPAC name is 1-(3-bromo-2,6-difluoro-5-methylphenyl)cyclopropane-1-carboxylic acid.
| Compound Name | 1-(3-bromo-2,6-difluoro-5-methylphenyl)cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 117469962 |
| Molecular Formula | C11H9BrF2O2 |
| Molecular Weight | 291.09 g/mol |
| Exact Mass | 289.98 |
| IUPAC Name | 1-(3-bromo-2,6-difluoro-5-methylphenyl)cyclopropane-1-carboxylic acid |
| SMILES | Cc1cc(Br)c(F)c(C2(C(=O)O)CC2)c1F |
| InChI | InChI=1S/C11H9BrF2O2/c1-5-4-6(12)9(14)7(8(5)13)11(2-3-11)10(15)16/h4H,2-3H2,1H3,(H,15,16) |
| InChIKey | CBPSTWZSWYIEMU-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.09 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|