C10H9BrF2O — CID 117411677
1-(3-bromo-2,6-difluoro-5-methylphenyl)cyclopropan-1-ol (PubChem CID 117411677) has the molecular formula C10H9BrF2O and a molecular weight of 263.08 g/mol. Its IUPAC name is 1-(3-bromo-2,6-difluoro-5-methylphenyl)cyclopropan-1-ol.
| Compound Name | 1-(3-bromo-2,6-difluoro-5-methylphenyl)cyclopropan-1-ol |
|---|---|
| PubChem CID | 117411677 |
| Molecular Formula | C10H9BrF2O |
| Molecular Weight | 263.08 g/mol |
| Exact Mass | 261.98 |
| IUPAC Name | 1-(3-bromo-2,6-difluoro-5-methylphenyl)cyclopropan-1-ol |
| SMILES | Cc1cc(Br)c(F)c(C2(O)CC2)c1F |
| InChI | InChI=1S/C10H9BrF2O/c1-5-4-6(11)9(13)7(8(5)12)10(14)2-3-10/h4,14H,2-3H2,1H3 |
| InChIKey | MRBNKYNXQMEGIH-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.08 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|