About 1-[2,3-dihydroxy-6-(trifluoromethyl)phenyl]cyclohexane-1-carboxylic acid
1-[2,3-dihydroxy-6-(trifluoromethyl)phenyl]cyclohexane-1-carboxylic acid (PubChem CID 117489484) has the molecular formula C14H15F3O4
and a molecular weight of 304.26 g/mol. Its IUPAC name is 1-[2,3-dihydroxy-6-(trifluoromethyl)phenyl]cyclohexane-1-carboxylic acid.
Molecular Properties
| Compound Name | 1-[2,3-dihydroxy-6-(trifluoromethyl)phenyl]cyclohexane-1-carboxylic acid |
| PubChem CID | 117489484 |
| Molecular Formula | C14H15F3O4 |
| Molecular Weight | 304.26 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | 1-[2,3-dihydroxy-6-(trifluoromethyl)phenyl]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1(c2c(C(F)(F)F)ccc(O)c2O)CCCCC1 |
| InChI | InChI=1S/C14H15F3O4/c15-14(16,17)8-4-5-9(18)11(19)10(8)13(12(20)21)6-2-1-3-7-13/h4-5,18-19H,1-3,6-7H2,(H,20,21) |
| InChIKey | OTHJQUDRDKIUIH-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.26 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 1-[2,3-dihydroxy-6-(trifluoromethyl)phenyl]cyclohexane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2,3-dihydroxy-6-(trifluoromethyl)phenyl]cyclohexane-1-carboxylic acid?
The IUPAC name of 1-[2,3-dihydroxy-6-(trifluoromethyl)phenyl]cyclohexane-1-carboxylic acid (CID 117489484) is 1-[2,3-dihydroxy-6-(trifluoromethyl)phenyl]cyclohexane-1-carboxylic acid.
What is the SMILES notation for 1-[2,3-dihydroxy-6-(trifluoromethyl)phenyl]cyclohexane-1-carboxylic acid?
The canonical SMILES for 1-[2,3-dihydroxy-6-(trifluoromethyl)phenyl]cyclohexane-1-carboxylic acid is O=C(O)C1(c2c(C(F)(F)F)ccc(O)c2O)CCCCC1.
What is the InChIKey of 1-[2,3-dihydroxy-6-(trifluoromethyl)phenyl]cyclohexane-1-carboxylic acid?
The InChIKey is OTHJQUDRDKIUIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15F3O4/c15-14(16,17)8-4-5-9(18)11(19)10(8)13(12(20)21)6-2-1-3-7-13/h4-5,18-19H,1-3,6-7H2,(H,20,21).
What are the key properties of 1-[2,3-dihydroxy-6-(trifluoromethyl)phenyl]cyclohexane-1-carboxylic acid?
1-[2,3-dihydroxy-6-(trifluoromethyl)phenyl]cyclohexane-1-carboxylic acid has a molecular weight of 304.26 g/mol, XLogP of 3.40, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2,3-dihydroxy-6-(trifluoromethyl)phenyl]cyclohexane-1-carboxylic acid is sourced from PubChem (CID 117489484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).