C14H15F3O4 — CID 117489484
1-[2,3-dihydroxy-6-(trifluoromethyl)phenyl]cyclohexane-1-carboxylic acid (PubChem CID 117489484) has the molecular formula C14H15F3O4 and a molecular weight of 304.26 g/mol. Its IUPAC name is 1-[2,3-dihydroxy-6-(trifluoromethyl)phenyl]cyclohexane-1-carboxylic acid.
| Compound Name | 1-[2,3-dihydroxy-6-(trifluoromethyl)phenyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 117489484 |
| Molecular Formula | C14H15F3O4 |
| Molecular Weight | 304.26 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | 1-[2,3-dihydroxy-6-(trifluoromethyl)phenyl]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1(c2c(C(F)(F)F)ccc(O)c2O)CCCCC1 |
| InChI | InChI=1S/C14H15F3O4/c15-14(16,17)8-4-5-9(18)11(19)10(8)13(12(20)21)6-2-1-3-7-13/h4-5,18-19H,1-3,6-7H2,(H,20,21) |
| InChIKey | OTHJQUDRDKIUIH-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.26 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|