C11H9F3O2 — CID 117331938
2-[1-(2,3,6-trifluorophenyl)cyclopropyl]acetic acid (PubChem CID 117331938) has the molecular formula C11H9F3O2 and a molecular weight of 230.18 g/mol. Its IUPAC name is 2-[1-(2,3,6-trifluorophenyl)cyclopropyl]acetic acid.
| Compound Name | 2-[1-(2,3,6-trifluorophenyl)cyclopropyl]acetic acid |
|---|---|
| PubChem CID | 117331938 |
| Molecular Formula | C11H9F3O2 |
| Molecular Weight | 230.18 g/mol |
| Exact Mass | 230.06 |
| IUPAC Name | 2-[1-(2,3,6-trifluorophenyl)cyclopropyl]acetic acid |
| SMILES | O=C(O)CC1(c2c(F)ccc(F)c2F)CC1 |
| InChI | InChI=1S/C11H9F3O2/c12-6-1-2-7(13)10(14)9(6)11(3-4-11)5-8(15)16/h1-2H,3-5H2,(H,15,16) |
| InChIKey | IFAFZNKPNBUEAZ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.18 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|