2-[1-(2,3,4,5,6-pentafluorophenyl)cyclopropyl]acetic acid

C11H7F5O2 — CID 117419143

IUPAC2-[1-(2,3,4,5,6-pentafluorophenyl)cyclopropyl]acetic acid
SMILESO=C(O)CC1(c2c(F)c(F)c(F)c(F)c2F)CC1
InChIInChI=1S/C11H7F5O2/c12-6-5(11(1-2-11)3-4(17)18)7(13)9(15)10(16)8(6)14/h1-3H2,(H,17,18)
InChIKeyOIRUUTAJRGOVTO-UHFFFAOYSA-N
MW266.16 g/mol
LogP2.89
Rot. Bonds3

About 2-[1-(2,3,4,5,6-pentafluorophenyl)cyclopropyl]acetic acid

2-[1-(2,3,4,5,6-pentafluorophenyl)cyclopropyl]acetic acid (PubChem CID 117419143) has the molecular formula C11H7F5O2 and a molecular weight of 266.16 g/mol. Its IUPAC name is 2-[1-(2,3,4,5,6-pentafluorophenyl)cyclopropyl]acetic acid.

Molecular Properties

Compound Name2-[1-(2,3,4,5,6-pentafluorophenyl)cyclopropyl]acetic acid
PubChem CID117419143
Molecular FormulaC11H7F5O2
Molecular Weight266.16 g/mol
Exact Mass266.04
IUPAC Name2-[1-(2,3,4,5,6-pentafluorophenyl)cyclopropyl]acetic acid
SMILESO=C(O)CC1(c2c(F)c(F)c(F)c(F)c2F)CC1
InChIInChI=1S/C11H7F5O2/c12-6-5(11(1-2-11)3-4(17)18)7(13)9(15)10(16)8(6)14/h1-3H2,(H,17,18)
InChIKeyOIRUUTAJRGOVTO-UHFFFAOYSA-N
XLogP2.89
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds3
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500266.16
LogP ≤ 52.89
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}

Analyze 2-[1-(2,3,4,5,6-pentafluorophenyl)cyclopropyl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[1-(2,3,4,5,6-pentafluorophenyl)cyclopropyl]acetic acid?
The IUPAC name of 2-[1-(2,3,4,5,6-pentafluorophenyl)cyclopropyl]acetic acid (CID 117419143) is 2-[1-(2,3,4,5,6-pentafluorophenyl)cyclopropyl]acetic acid.
What is the SMILES notation for 2-[1-(2,3,4,5,6-pentafluorophenyl)cyclopropyl]acetic acid?
The canonical SMILES for 2-[1-(2,3,4,5,6-pentafluorophenyl)cyclopropyl]acetic acid is O=C(O)CC1(c2c(F)c(F)c(F)c(F)c2F)CC1.
What is the InChIKey of 2-[1-(2,3,4,5,6-pentafluorophenyl)cyclopropyl]acetic acid?
The InChIKey is OIRUUTAJRGOVTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7F5O2/c12-6-5(11(1-2-11)3-4(17)18)7(13)9(15)10(16)8(6)14/h1-3H2,(H,17,18).
What are the key properties of 2-[1-(2,3,4,5,6-pentafluorophenyl)cyclopropyl]acetic acid?
2-[1-(2,3,4,5,6-pentafluorophenyl)cyclopropyl]acetic acid has a molecular weight of 266.16 g/mol, XLogP of 2.89, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(2,3,4,5,6-pentafluorophenyl)cyclopropyl]acetic acid is sourced from PubChem (CID 117419143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).