C11H11FO4 — CID 84790843
2-[1-(2-fluoro-3,6-dihydroxyphenyl)cyclopropyl]acetic acid (PubChem CID 84790843) has the molecular formula C11H11FO4 and a molecular weight of 226.20 g/mol. Its IUPAC name is 2-[1-(2-fluoro-3,6-dihydroxyphenyl)cyclopropyl]acetic acid.
| Compound Name | 2-[1-(2-fluoro-3,6-dihydroxyphenyl)cyclopropyl]acetic acid |
|---|---|
| PubChem CID | 84790843 |
| Molecular Formula | C11H11FO4 |
| Molecular Weight | 226.20 g/mol |
| Exact Mass | 226.06 |
| IUPAC Name | 2-[1-(2-fluoro-3,6-dihydroxyphenyl)cyclopropyl]acetic acid |
| SMILES | O=C(O)CC1(c2c(O)ccc(O)c2F)CC1 |
| InChI | InChI=1S/C11H11FO4/c12-10-7(14)2-1-6(13)9(10)11(3-4-11)5-8(15)16/h1-2,13-14H,3-5H2,(H,15,16) |
| InChIKey | RFELPCOMOVLRTK-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.20 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|