C16H21NO5 — CID 11381252
ethyl (1S,3S,10R,11R)-10-ethyl-5,13-dioxo-12-oxa-6-azatetracyclo[8.2.1.03,11.06,11]tridecane-1-carboxylate (PubChem CID 11381252) has the molecular formula C16H21NO5 and a molecular weight of 307.35 g/mol. Its IUPAC name is ethyl (1S,3S,10R,11R)-10-ethyl-5,13-dioxo-12-oxa-6-azatetracyclo[8.2.1.03,11.06,11]tridecane-1-carboxylate.
| Compound Name | ethyl (1S,3S,10R,11R)-10-ethyl-5,13-dioxo-12-oxa-6-azatetracyclo[8.2.1.03,11.06,11]tridecane-1-carboxylate |
|---|---|
| PubChem CID | 11381252 |
| Molecular Formula | C16H21NO5 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | ethyl (1S,3S,10R,11R)-10-ethyl-5,13-dioxo-12-oxa-6-azatetracyclo[8.2.1.03,11.06,11]tridecane-1-carboxylate |
| SMILES | CCOC(=O)[C@]12C[C@H]3CC(=O)N4CCC[C@@](CC)(C1=O)[C@]34O2 |
| InChI | InChI=1S/C16H21NO5/c1-3-14-6-5-7-17-11(18)8-10-9-15(12(14)19,13(20)21-4-2)22-16(10,14)17/h10H,3-9H2,1-2H3/t10-,14+,15+,16-/m1/s1 |
| InChIKey | AOQDIZPLWLPZGN-GCUJQHFUSA-N |
| XLogP | 1.03 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|