C21H21NO7 — CID 101153686
diethyl 8,13-dioxo-15-oxa-9-azapentacyclo[12.2.1.02,7.09,16.012,16]heptadeca-2,4,6-triene-12,14-dicarboxylate (PubChem CID 101153686) has the molecular formula C21H21NO7 and a molecular weight of 399.40 g/mol. Its IUPAC name is diethyl 8,13-dioxo-15-oxa-9-azapentacyclo[12.2.1.02,7.09,16.012,16]heptadeca-2,4,6-triene-12,14-dicarboxylate.
| Compound Name | diethyl 8,13-dioxo-15-oxa-9-azapentacyclo[12.2.1.02,7.09,16.012,16]heptadeca-2,4,6-triene-12,14-dicarboxylate |
|---|---|
| PubChem CID | 101153686 |
| Molecular Formula | C21H21NO7 |
| Molecular Weight | 399.40 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | diethyl 8,13-dioxo-15-oxa-9-azapentacyclo[12.2.1.02,7.09,16.012,16]heptadeca-2,4,6-triene-12,14-dicarboxylate |
| SMILES | CCOC(=O)C12CC3c4ccccc4C(=O)N4CCC(C(=O)OCC)(C1=O)C34O2 |
| InChI | InChI=1S/C21H21NO7/c1-3-27-17(25)19-9-10-22-15(23)13-8-6-5-7-12(13)14-11-20(16(19)24,18(26)28-4-2)29-21(14,19)22/h5-8,14H,3-4,9-11H2,1-2H3 |
| InChIKey | BXYFPLBNIVWGFG-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.40 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|