C16H19NO4 — CID 97170543
ethyl (1R)-2-(oxan-4-yl)-3-oxo-1H-isoindole-1-carboxylate (PubChem CID 97170543) has the molecular formula C16H19NO4 and a molecular weight of 289.33 g/mol. Its IUPAC name is ethyl (1R)-2-(oxan-4-yl)-3-oxo-1H-isoindole-1-carboxylate.
| Compound Name | ethyl (1R)-2-(oxan-4-yl)-3-oxo-1H-isoindole-1-carboxylate |
|---|---|
| PubChem CID | 97170543 |
| Molecular Formula | C16H19NO4 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | ethyl (1R)-2-(oxan-4-yl)-3-oxo-1H-isoindole-1-carboxylate |
| SMILES | CCOC(=O)[C@H]1c2ccccc2C(=O)N1C1CCOCC1 |
| InChI | InChI=1S/C16H19NO4/c1-2-21-16(19)14-12-5-3-4-6-13(12)15(18)17(14)11-7-9-20-10-8-11/h3-6,11,14H,2,7-10H2,1H3/t14-/m1/s1 |
| InChIKey | CXCUHBIFWVHRHC-CQSZACIVSA-N |
| XLogP | 1.93 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |