C23H25NO5 — CID 57138770
ethyl 2-(3-cyclopentyloxy-4-methoxyphenyl)-3-oxo-1H-isoindole-1-carboxylate (PubChem CID 57138770) has the molecular formula C23H25NO5 and a molecular weight of 395.46 g/mol. Its IUPAC name is ethyl 2-(3-cyclopentyloxy-4-methoxyphenyl)-3-oxo-1H-isoindole-1-carboxylate.
| Compound Name | ethyl 2-(3-cyclopentyloxy-4-methoxyphenyl)-3-oxo-1H-isoindole-1-carboxylate |
|---|---|
| PubChem CID | 57138770 |
| Molecular Formula | C23H25NO5 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | ethyl 2-(3-cyclopentyloxy-4-methoxyphenyl)-3-oxo-1H-isoindole-1-carboxylate |
| SMILES | CCOC(=O)C1c2ccccc2C(=O)N1c1ccc(OC)c(OC2CCCC2)c1 |
| InChI | InChI=1S/C23H25NO5/c1-3-28-23(26)21-17-10-6-7-11-18(17)22(25)24(21)15-12-13-19(27-2)20(14-15)29-16-8-4-5-9-16/h6-7,10-14,16,21H,3-5,8-9H2,1-2H3 |
| InChIKey | XEWPMLGEOCNLNK-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |