C24H27NO3 — CID 142627972
2-(3-cyclopentyloxy-4-methoxyphenyl)-3-ethenyl-5,6-dimethyl-3H-isoindol-1-one (PubChem CID 142627972) has the molecular formula C24H27NO3 and a molecular weight of 377.48 g/mol. Its IUPAC name is 2-(3-cyclopentyloxy-4-methoxyphenyl)-3-ethenyl-5,6-dimethyl-3H-isoindol-1-one.
| Compound Name | 2-(3-cyclopentyloxy-4-methoxyphenyl)-3-ethenyl-5,6-dimethyl-3H-isoindol-1-one |
|---|---|
| PubChem CID | 142627972 |
| Molecular Formula | C24H27NO3 |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | 2-(3-cyclopentyloxy-4-methoxyphenyl)-3-ethenyl-5,6-dimethyl-3H-isoindol-1-one |
| SMILES | C=CC1c2cc(C)c(C)cc2C(=O)N1c1ccc(OC)c(OC2CCCC2)c1 |
| InChI | InChI=1S/C24H27NO3/c1-5-21-19-12-15(2)16(3)13-20(19)24(26)25(21)17-10-11-22(27-4)23(14-17)28-18-8-6-7-9-18/h5,10-14,18,21H,1,6-9H2,2-4H3 |
| InChIKey | OLDDWXCVOPYPRX-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|