C26H23NO3 — CID 142627953
2-[3-(2,3-dihydro-1H-inden-2-yloxy)-4-methoxyphenyl]-3-ethenyl-3H-isoindol-1-one (PubChem CID 142627953) has the molecular formula C26H23NO3 and a molecular weight of 397.47 g/mol. Its IUPAC name is 2-[3-(2,3-dihydro-1H-inden-2-yloxy)-4-methoxyphenyl]-3-ethenyl-3H-isoindol-1-one.
| Compound Name | 2-[3-(2,3-dihydro-1H-inden-2-yloxy)-4-methoxyphenyl]-3-ethenyl-3H-isoindol-1-one |
|---|---|
| PubChem CID | 142627953 |
| Molecular Formula | C26H23NO3 |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | 2-[3-(2,3-dihydro-1H-inden-2-yloxy)-4-methoxyphenyl]-3-ethenyl-3H-isoindol-1-one |
| SMILES | C=CC1c2ccccc2C(=O)N1c1ccc(OC)c(OC2Cc3ccccc3C2)c1 |
| InChI | InChI=1S/C26H23NO3/c1-3-23-21-10-6-7-11-22(21)26(28)27(23)19-12-13-24(29-2)25(16-19)30-20-14-17-8-4-5-9-18(17)15-20/h3-13,16,20,23H,1,14-15H2,2H3 |
| InChIKey | VBZVWAOHMKDWMC-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|