C19H24N2O3 — CID 4644788
2-cyclopentyl-3-oxo-N-(oxolan-2-ylmethyl)-1H-isoindole-1-carboxamide (PubChem CID 4644788) has the molecular formula C19H24N2O3 and a molecular weight of 328.41 g/mol. Its IUPAC name is 2-cyclopentyl-3-oxo-N-(oxolan-2-ylmethyl)-1H-isoindole-1-carboxamide.
| Compound Name | 2-cyclopentyl-3-oxo-N-(oxolan-2-ylmethyl)-1H-isoindole-1-carboxamide |
|---|---|
| PubChem CID | 4644788 |
| Molecular Formula | C19H24N2O3 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | 2-cyclopentyl-3-oxo-N-(oxolan-2-ylmethyl)-1H-isoindole-1-carboxamide |
| SMILES | O=C(NCC1CCCO1)C1c2ccccc2C(=O)N1C1CCCC1 |
| InChI | InChI=1S/C19H24N2O3/c22-18(20-12-14-8-5-11-24-14)17-15-9-3-4-10-16(15)19(23)21(17)13-6-1-2-7-13/h3-4,9-10,13-14,17H,1-2,5-8,11-12H2,(H,20,22) |
| InChIKey | FCAATOHEORQJKU-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |