C19H19NO3 — CID 752957
N-[[(2S)-oxolan-2-yl]methyl]-9H-xanthene-9-carboxamide (PubChem CID 752957) has the molecular formula C19H19NO3 and a molecular weight of 309.37 g/mol. Its IUPAC name is N-[[(2S)-oxolan-2-yl]methyl]-9H-xanthene-9-carboxamide.
| Compound Name | N-[[(2S)-oxolan-2-yl]methyl]-9H-xanthene-9-carboxamide |
|---|---|
| PubChem CID | 752957 |
| Molecular Formula | C19H19NO3 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | N-[[(2S)-oxolan-2-yl]methyl]-9H-xanthene-9-carboxamide |
| SMILES | O=C(NC[C@@H]1CCCO1)C1c2ccccc2Oc2ccccc21 |
| InChI | InChI=1S/C19H19NO3/c21-19(20-12-13-6-5-11-22-13)18-14-7-1-3-9-16(14)23-17-10-4-2-8-15(17)18/h1-4,7-10,13,18H,5-6,11-12H2,(H,20,21)/t13-/m0/s1 |
| InChIKey | KXIIYHAWLFMQGB-ZDUSSCGKSA-N |
| XLogP | 3.22 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |