C28H28N2O6 — CID 10814855
ethyl (1S,6R,8R,9R,13S)-2-benzyl-6-methyl-7,10,12-trioxo-11-phenyl-14-oxa-2,11-diazatetracyclo[6.5.1.01,6.09,13]tetradecane-8-carboxylate (PubChem CID 10814855) has the molecular formula C28H28N2O6 and a molecular weight of 488.54 g/mol. Its IUPAC name is ethyl (1S,6R,8R,9R,13S)-2-benzyl-6-methyl-7,10,12-trioxo-11-phenyl-14-oxa-2,11-diazatetracyclo[6.5.1.01,6.09,13]tetradecane-8-carboxylate.
| Compound Name | ethyl (1S,6R,8R,9R,13S)-2-benzyl-6-methyl-7,10,12-trioxo-11-phenyl-14-oxa-2,11-diazatetracyclo[6.5.1.01,6.09,13]tetradecane-8-carboxylate |
|---|---|
| PubChem CID | 10814855 |
| Molecular Formula | C28H28N2O6 |
| Molecular Weight | 488.54 g/mol |
| Exact Mass | 488.19 |
| IUPAC Name | ethyl (1S,6R,8R,9R,13S)-2-benzyl-6-methyl-7,10,12-trioxo-11-phenyl-14-oxa-2,11-diazatetracyclo[6.5.1.01,6.09,13]tetradecane-8-carboxylate |
| SMILES | CCOC(=O)[C@@]12O[C@]3([C@H]4C(=O)N(c5ccccc5)C(=O)[C@H]41)N(Cc1ccccc1)CCC[C@@]3(C)C2=O |
| InChI | InChI=1S/C28H28N2O6/c1-3-35-25(34)27-20-21(23(32)30(22(20)31)19-13-8-5-9-14-19)28(36-27)26(2,24(27)33)15-10-16-29(28)17-18-11-6-4-7-12-18/h4-9,11-14,20-21H,3,10,15-17H2,1-2H3/t20-,21+,26-,27+,28-/m0/s1 |
| InChIKey | VXRGDNPVFSIEKA-RZEXAMLZSA-N |
| XLogP | 2.71 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.54 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|