C20H20N2O6 — CID 10500219
ethyl (1R,2R,6S,7S,12S)-12-methyl-3,5,8-trioxo-4-phenyl-13-oxa-4,9-diazatetracyclo[5.5.1.01,9.02,6]tridecane-7-carboxylate (PubChem CID 10500219) has the molecular formula C20H20N2O6 and a molecular weight of 384.39 g/mol. Its IUPAC name is ethyl (1R,2R,6S,7S,12S)-12-methyl-3,5,8-trioxo-4-phenyl-13-oxa-4,9-diazatetracyclo[5.5.1.01,9.02,6]tridecane-7-carboxylate.
| Compound Name | ethyl (1R,2R,6S,7S,12S)-12-methyl-3,5,8-trioxo-4-phenyl-13-oxa-4,9-diazatetracyclo[5.5.1.01,9.02,6]tridecane-7-carboxylate |
|---|---|
| PubChem CID | 10500219 |
| Molecular Formula | C20H20N2O6 |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | ethyl (1R,2R,6S,7S,12S)-12-methyl-3,5,8-trioxo-4-phenyl-13-oxa-4,9-diazatetracyclo[5.5.1.01,9.02,6]tridecane-7-carboxylate |
| SMILES | CCOC(=O)[C@]12O[C@@]3([C@@H]4C(=O)N(c5ccccc5)C(=O)[C@@H]41)[C@@H](C)CCN3C2=O |
| InChI | InChI=1S/C20H20N2O6/c1-3-27-18(26)19-13-14(20(28-19)11(2)9-10-21(20)17(19)25)16(24)22(15(13)23)12-7-5-4-6-8-12/h4-8,11,13-14H,3,9-10H2,1-2H3/t11-,13+,14-,19-,20+/m0/s1 |
| InChIKey | DACFQSUDXSNZAD-LNUJHOGGSA-N |
| XLogP | 0.70 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|