C46H39N7O6 — CID 102358326
ethyl (2S,6R,7S,9S,10R,14S)-7,9-bis(3-methyl-1-phenylpyrazol-4-yl)-3,5,11,13-tetraoxo-4,12-diphenyl-4,8,12-triazatetracyclo[6.6.0.02,6.010,14]tetradecane-1-carboxylate (PubChem CID 102358326) has the molecular formula C46H39N7O6 and a molecular weight of 785.86 g/mol. Its IUPAC name is ethyl (2S,6R,7S,9S,10R,14S)-7,9-bis(3-methyl-1-phenylpyrazol-4-yl)-3,5,11,13-tetraoxo-4,12-diphenyl-4,8,12-triazatetracyclo[6.6.0.02,6.010,14]tetradecane-1-carboxylate.
| Compound Name | ethyl (2S,6R,7S,9S,10R,14S)-7,9-bis(3-methyl-1-phenylpyrazol-4-yl)-3,5,11,13-tetraoxo-4,12-diphenyl-4,8,12-triazatetracyclo[6.6.0.02,6.010,14]tetradecane-1-carboxylate |
|---|---|
| PubChem CID | 102358326 |
| Molecular Formula | C46H39N7O6 |
| Molecular Weight | 785.86 g/mol |
| Exact Mass | 785.30 |
| IUPAC Name | ethyl (2S,6R,7S,9S,10R,14S)-7,9-bis(3-methyl-1-phenylpyrazol-4-yl)-3,5,11,13-tetraoxo-4,12-diphenyl-4,8,12-triazatetracyclo[6.6.0.02,6.010,14]tetradecane-1-carboxylate |
| SMILES | CCOC(=O)C12[C@H]3C(=O)N(c4ccccc4)C(=O)[C@H]3[C@@H](c3cn(-c4ccccc4)nc3C)N1[C@H](c1cn(-c3ccccc3)nc1C)[C@@H]1C(=O)N(c3ccccc3)C(=O)[C@@H]12 |
| InChI | InChI=1S/C46H39N7O6/c1-4-59-45(58)46-37-35(41(54)51(43(37)56)31-21-13-7-14-22-31)39(33-25-49(47-27(33)2)29-17-9-5-10-18-29)53(46)40(34-26-50(48-28(34)3)30-19-11-6-12-20-30)36-38(46)44(57)52(42(36)55)32-23-15-8-16-24-32/h5-26,35-40H,4H2,1-3H3/t35-,36-,37-,38-,39-,40-/m1/s1 |
| InChIKey | IPZBUBJIUWIULD-ZNAXKYJTSA-N |
| XLogP | 5.70 |
| TPSA | 139.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 785.86 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|