C28H30N4O4 — CID 155813077
methyl (1S,3R,3aS,6aR)-5-(4-methylphenyl)-1-(3-methyl-1-phenylpyrazol-4-yl)-4,6-dioxo-3-propan-2-yl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate (PubChem CID 155813077) has the molecular formula C28H30N4O4 and a molecular weight of 486.57 g/mol. Its IUPAC name is methyl (1S,3R,3aS,6aR)-5-(4-methylphenyl)-1-(3-methyl-1-phenylpyrazol-4-yl)-4,6-dioxo-3-propan-2-yl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate.
| Compound Name | methyl (1S,3R,3aS,6aR)-5-(4-methylphenyl)-1-(3-methyl-1-phenylpyrazol-4-yl)-4,6-dioxo-3-propan-2-yl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 155813077 |
| Molecular Formula | C28H30N4O4 |
| Molecular Weight | 486.57 g/mol |
| Exact Mass | 486.23 |
| IUPAC Name | methyl (1S,3R,3aS,6aR)-5-(4-methylphenyl)-1-(3-methyl-1-phenylpyrazol-4-yl)-4,6-dioxo-3-propan-2-yl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate |
| SMILES | COC(=O)[C@]1(C(C)C)N[C@H](c2cn(-c3ccccc3)nc2C)[C@@H]2C(=O)N(c3ccc(C)cc3)C(=O)[C@@H]21 |
| InChI | InChI=1S/C28H30N4O4/c1-16(2)28(27(35)36-5)23-22(25(33)32(26(23)34)20-13-11-17(3)12-14-20)24(29-28)21-15-31(30-18(21)4)19-9-7-6-8-10-19/h6-16,22-24,29H,1-5H3/t22-,23-,24-,28-/m1/s1 |
| InChIKey | CSKUYDILDNZBMK-CBUXHAPBSA-N |
| XLogP | 3.51 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.57 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|