C17H25NO5 — CID 129371782
diethyl (3aR,4aR,8aS)-4-oxo-2,3,3a,4a,5,7,8,8a-octahydro-1H-pyrrolo[1,2-a]indole-6,6-dicarboxylate (PubChem CID 129371782) has the molecular formula C17H25NO5 and a molecular weight of 323.39 g/mol. Its IUPAC name is diethyl (3aR,4aR,8aS)-4-oxo-2,3,3a,4a,5,7,8,8a-octahydro-1H-pyrrolo[1,2-a]indole-6,6-dicarboxylate.
| Compound Name | diethyl (3aR,4aR,8aS)-4-oxo-2,3,3a,4a,5,7,8,8a-octahydro-1H-pyrrolo[1,2-a]indole-6,6-dicarboxylate |
|---|---|
| PubChem CID | 129371782 |
| Molecular Formula | C17H25NO5 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | diethyl (3aR,4aR,8aS)-4-oxo-2,3,3a,4a,5,7,8,8a-octahydro-1H-pyrrolo[1,2-a]indole-6,6-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)CC[C@H]2[C@@H](C1)C(=O)[C@H]1CCCN12 |
| InChI | InChI=1S/C17H25NO5/c1-3-22-15(20)17(16(21)23-4-2)8-7-12-11(10-17)14(19)13-6-5-9-18(12)13/h11-13H,3-10H2,1-2H3/t11-,12+,13-/m1/s1 |
| InChIKey | ASTMRLPYJIVQKR-FRRDWIJNSA-N |
| XLogP | 1.31 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|