C11H18ClNO6S — CID 86000209
diethyl 1-chlorosulfonylpiperidine-4,4-dicarboxylate (PubChem CID 86000209) has the molecular formula C11H18ClNO6S and a molecular weight of 327.79 g/mol. Its IUPAC name is diethyl 1-chlorosulfonylpiperidine-4,4-dicarboxylate.
| Compound Name | diethyl 1-chlorosulfonylpiperidine-4,4-dicarboxylate |
|---|---|
| PubChem CID | 86000209 |
| Molecular Formula | C11H18ClNO6S |
| Molecular Weight | 327.79 g/mol |
| Exact Mass | 327.05 |
| IUPAC Name | diethyl 1-chlorosulfonylpiperidine-4,4-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)CCN(S(=O)(=O)Cl)CC1 |
| InChI | InChI=1S/C11H18ClNO6S/c1-3-18-9(14)11(10(15)19-4-2)5-7-13(8-6-11)20(12,16)17/h3-8H2,1-2H3 |
| InChIKey | YWTMPCNGSUXNHD-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.79 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|