C11H21NO4S — CID 124626361
ethyl (3R)-1-methylsulfonyl-3-propan-2-ylpyrrolidine-3-carboxylate (PubChem CID 124626361) has the molecular formula C11H21NO4S and a molecular weight of 263.36 g/mol. Its IUPAC name is ethyl (3R)-1-methylsulfonyl-3-propan-2-ylpyrrolidine-3-carboxylate.
| Compound Name | ethyl (3R)-1-methylsulfonyl-3-propan-2-ylpyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 124626361 |
| Molecular Formula | C11H21NO4S |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | ethyl (3R)-1-methylsulfonyl-3-propan-2-ylpyrrolidine-3-carboxylate |
| SMILES | CCOC(=O)[C@@]1(C(C)C)CCN(S(C)(=O)=O)C1 |
| InChI | InChI=1S/C11H21NO4S/c1-5-16-10(13)11(9(2)3)6-7-12(8-11)17(4,14)15/h9H,5-8H2,1-4H3/t11-/m0/s1 |
| InChIKey | UWZFMKVCQWFLTI-NSHDSACASA-N |
| XLogP | 0.86 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |