About ethyl (3S)-3-propan-2-yl-1-(3,3,3-trifluoropropanoyl)pyrrolidine-3-carboxylate
ethyl (3S)-3-propan-2-yl-1-(3,3,3-trifluoropropanoyl)pyrrolidine-3-carboxylate (PubChem CID 99841022) has the molecular formula C13H20F3NO3
and a molecular weight of 295.30 g/mol. Its IUPAC name is ethyl (3S)-3-propan-2-yl-1-(3,3,3-trifluoropropanoyl)pyrrolidine-3-carboxylate.
Molecular Properties
| Compound Name | ethyl (3S)-3-propan-2-yl-1-(3,3,3-trifluoropropanoyl)pyrrolidine-3-carboxylate |
| PubChem CID | 99841022 |
| Molecular Formula | C13H20F3NO3 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | ethyl (3S)-3-propan-2-yl-1-(3,3,3-trifluoropropanoyl)pyrrolidine-3-carboxylate |
| SMILES | CCOC(=O)[C@]1(C(C)C)CCN(C(=O)CC(F)(F)F)C1 |
| InChI | InChI=1S/C13H20F3NO3/c1-4-20-11(19)12(9(2)3)5-6-17(8-12)10(18)7-13(14,15)16/h9H,4-8H2,1-3H3/t12-/m1/s1 |
| InChIKey | XOJDSRMRFXNTBM-GFCCVEGCSA-N |
| XLogP | 2.38 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl (3S)-3-propan-2-yl-1-(3,3,3-trifluoropropanoyl)pyrrolidine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (3S)-3-propan-2-yl-1-(3,3,3-trifluoropropanoyl)pyrrolidine-3-carboxylate?
The IUPAC name of ethyl (3S)-3-propan-2-yl-1-(3,3,3-trifluoropropanoyl)pyrrolidine-3-carboxylate (CID 99841022) is ethyl (3S)-3-propan-2-yl-1-(3,3,3-trifluoropropanoyl)pyrrolidine-3-carboxylate.
What is the SMILES notation for ethyl (3S)-3-propan-2-yl-1-(3,3,3-trifluoropropanoyl)pyrrolidine-3-carboxylate?
The canonical SMILES for ethyl (3S)-3-propan-2-yl-1-(3,3,3-trifluoropropanoyl)pyrrolidine-3-carboxylate is CCOC(=O)[C@]1(C(C)C)CCN(C(=O)CC(F)(F)F)C1.
What is the InChIKey of ethyl (3S)-3-propan-2-yl-1-(3,3,3-trifluoropropanoyl)pyrrolidine-3-carboxylate?
The InChIKey is XOJDSRMRFXNTBM-GFCCVEGCSA-N. The full InChI is InChI=1S/C13H20F3NO3/c1-4-20-11(19)12(9(2)3)5-6-17(8-12)10(18)7-13(14,15)16/h9H,4-8H2,1-3H3/t12-/m1/s1.
What are the key properties of ethyl (3S)-3-propan-2-yl-1-(3,3,3-trifluoropropanoyl)pyrrolidine-3-carboxylate?
ethyl (3S)-3-propan-2-yl-1-(3,3,3-trifluoropropanoyl)pyrrolidine-3-carboxylate has a molecular weight of 295.30 g/mol, XLogP of 2.38, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (3S)-3-propan-2-yl-1-(3,3,3-trifluoropropanoyl)pyrrolidine-3-carboxylate is sourced from PubChem (CID 99841022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).