C17H25NO4S — CID 125139045
ethyl (3R)-1-(2-methylsulfonylphenyl)-3-propan-2-ylpyrrolidine-3-carboxylate (PubChem CID 125139045) has the molecular formula C17H25NO4S and a molecular weight of 339.46 g/mol. Its IUPAC name is ethyl (3R)-1-(2-methylsulfonylphenyl)-3-propan-2-ylpyrrolidine-3-carboxylate.
| Compound Name | ethyl (3R)-1-(2-methylsulfonylphenyl)-3-propan-2-ylpyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 125139045 |
| Molecular Formula | C17H25NO4S |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | ethyl (3R)-1-(2-methylsulfonylphenyl)-3-propan-2-ylpyrrolidine-3-carboxylate |
| SMILES | CCOC(=O)[C@@]1(C(C)C)CCN(c2ccccc2S(C)(=O)=O)C1 |
| InChI | InChI=1S/C17H25NO4S/c1-5-22-16(19)17(13(2)3)10-11-18(12-17)14-8-6-7-9-15(14)23(4,20)21/h6-9,13H,5,10-12H2,1-4H3/t17-/m0/s1 |
| InChIKey | KEFXMHAFEBXPPN-KRWDZBQOSA-N |
| XLogP | 2.51 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |