C12H16N2O4S — CID 55166923
3-methyl-1-(2-sulfamoylphenyl)pyrrolidine-3-carboxylic acid (PubChem CID 55166923) has the molecular formula C12H16N2O4S and a molecular weight of 284.34 g/mol. Its IUPAC name is 3-methyl-1-(2-sulfamoylphenyl)pyrrolidine-3-carboxylic acid.
| Compound Name | 3-methyl-1-(2-sulfamoylphenyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 55166923 |
| Molecular Formula | C12H16N2O4S |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 3-methyl-1-(2-sulfamoylphenyl)pyrrolidine-3-carboxylic acid |
| SMILES | CC1(C(=O)O)CCN(c2ccccc2S(N)(=O)=O)C1 |
| InChI | InChI=1S/C12H16N2O4S/c1-12(11(15)16)6-7-14(8-12)9-4-2-3-5-10(9)19(13,17)18/h2-5H,6-8H2,1H3,(H,15,16)(H2,13,17,18) |
| InChIKey | YRGHXAUJZOPQOC-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |