C16H28N2O3 — CID 79647422
ethyl 3-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl)-1-aminocyclopentane-1-carboxylate (PubChem CID 79647422) has the molecular formula C16H28N2O3 and a molecular weight of 296.41 g/mol. Its IUPAC name is ethyl 3-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl)-1-aminocyclopentane-1-carboxylate.
| Compound Name | ethyl 3-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl)-1-aminocyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 79647422 |
| Molecular Formula | C16H28N2O3 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.21 |
| IUPAC Name | ethyl 3-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl)-1-aminocyclopentane-1-carboxylate |
| SMILES | CCOC(=O)C1(N)CCC(N2CCOC3CCCCC32)C1 |
| InChI | InChI=1S/C16H28N2O3/c1-2-20-15(19)16(17)8-7-12(11-16)18-9-10-21-14-6-4-3-5-13(14)18/h12-14H,2-11,17H2,1H3 |
| InChIKey | GNKHQDPWFNKYLN-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |