C14H25N3O2 — CID 79655518
3-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl)-1-aminocyclopentane-1-carboxamide (PubChem CID 79655518) has the molecular formula C14H25N3O2 and a molecular weight of 267.37 g/mol. Its IUPAC name is 3-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl)-1-aminocyclopentane-1-carboxamide.
| Compound Name | 3-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl)-1-aminocyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 79655518 |
| Molecular Formula | C14H25N3O2 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.19 |
| IUPAC Name | 3-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl)-1-aminocyclopentane-1-carboxamide |
| SMILES | NC(=O)C1(N)CCC(N2CCOC3CCCCC32)C1 |
| InChI | InChI=1S/C14H25N3O2/c15-13(18)14(16)6-5-10(9-14)17-7-8-19-12-4-2-1-3-11(12)17/h10-12H,1-9,16H2,(H2,15,18) |
| InChIKey | GFGZOBPDVKWIIU-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 81.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |