C15H28N2O3 — CID 107394788
ethyl 1-amino-3-(3-methoxy-3-methylpiperidin-1-yl)cyclopentane-1-carboxylate (PubChem CID 107394788) has the molecular formula C15H28N2O3 and a molecular weight of 284.40 g/mol. Its IUPAC name is ethyl 1-amino-3-(3-methoxy-3-methylpiperidin-1-yl)cyclopentane-1-carboxylate.
| Compound Name | ethyl 1-amino-3-(3-methoxy-3-methylpiperidin-1-yl)cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 107394788 |
| Molecular Formula | C15H28N2O3 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.21 |
| IUPAC Name | ethyl 1-amino-3-(3-methoxy-3-methylpiperidin-1-yl)cyclopentane-1-carboxylate |
| SMILES | CCOC(=O)C1(N)CCC(N2CCCC(C)(OC)C2)C1 |
| InChI | InChI=1S/C15H28N2O3/c1-4-20-13(18)15(16)8-6-12(10-15)17-9-5-7-14(2,11-17)19-3/h12H,4-11,16H2,1-3H3 |
| InChIKey | HIYMZRGRUUBRLS-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |