C16H22O6 — CID 101111055
diethyl (6E)-6-(methoxymethylidene)-5-oxo-3,3a,4,6a-tetrahydro-1H-pentalene-2,2-dicarboxylate (PubChem CID 101111055) has the molecular formula C16H22O6 and a molecular weight of 310.35 g/mol. Its IUPAC name is diethyl (6E)-6-(methoxymethylidene)-5-oxo-3,3a,4,6a-tetrahydro-1H-pentalene-2,2-dicarboxylate.
| Compound Name | diethyl (6E)-6-(methoxymethylidene)-5-oxo-3,3a,4,6a-tetrahydro-1H-pentalene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 101111055 |
| Molecular Formula | C16H22O6 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | diethyl (6E)-6-(methoxymethylidene)-5-oxo-3,3a,4,6a-tetrahydro-1H-pentalene-2,2-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)CC2CC(=O)/C(=C/OC)C2C1 |
| InChI | InChI=1S/C16H22O6/c1-4-21-14(18)16(15(19)22-5-2)7-10-6-13(17)12(9-20-3)11(10)8-16/h9-11H,4-8H2,1-3H3/b12-9+ |
| InChIKey | XDSCBYOSYAMBNK-FMIVXFBMSA-N |
| XLogP | 1.63 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|