C35H34N2O8S — CID 101399223
ethyl (1S,2R,10S,17S,18R)-3-(benzenesulfonyl)-12,20-dioxo-17-(2-phenylmethoxyethyl)-19-oxa-3,13-diazahexacyclo[15.2.1.02,10.04,9.010,18.013,18]icosa-4,6,8-triene-1-carboxylate (PubChem CID 101399223) has the molecular formula C35H34N2O8S and a molecular weight of 642.73 g/mol. Its IUPAC name is ethyl (1S,2R,10S,17S,18R)-3-(benzenesulfonyl)-12,20-dioxo-17-(2-phenylmethoxyethyl)-19-oxa-3,13-diazahexacyclo[15.2.1.02,10.04,9.010,18.013,18]icosa-4,6,8-triene-1-carboxylate.
| Compound Name | ethyl (1S,2R,10S,17S,18R)-3-(benzenesulfonyl)-12,20-dioxo-17-(2-phenylmethoxyethyl)-19-oxa-3,13-diazahexacyclo[15.2.1.02,10.04,9.010,18.013,18]icosa-4,6,8-triene-1-carboxylate |
|---|---|
| PubChem CID | 101399223 |
| Molecular Formula | C35H34N2O8S |
| Molecular Weight | 642.73 g/mol |
| Exact Mass | 642.20 |
| IUPAC Name | ethyl (1S,2R,10S,17S,18R)-3-(benzenesulfonyl)-12,20-dioxo-17-(2-phenylmethoxyethyl)-19-oxa-3,13-diazahexacyclo[15.2.1.02,10.04,9.010,18.013,18]icosa-4,6,8-triene-1-carboxylate |
| SMILES | CCOC(=O)[C@@]12O[C@@]34N(CCC[C@@]3(CCOCc3ccccc3)C1=O)C(=O)C[C@@]41c3ccccc3N(S(=O)(=O)c3ccccc3)[C@@H]21 |
| InChI | InChI=1S/C35H34N2O8S/c1-2-44-31(40)34-29-33(26-16-9-10-17-27(26)37(29)46(41,42)25-14-7-4-8-15-25)22-28(38)36-20-11-18-32(30(34)39,35(33,36)45-34)19-21-43-23-24-12-5-3-6-13-24/h3-10,12-17,29H,2,11,18-23H2,1H3/t29-,32-,33+,34+,35+/m1/s1 |
| InChIKey | WYMNOSUBRDACAM-UKRAXMGASA-N |
| XLogP | 3.73 |
| TPSA | 119.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.73 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|