C16H19NO5 — CID 101230856
ethyl 3-oxo-7a-phenylmethoxy-6,7-dihydro-5H-pyrrolo[2,1-b][1,3]oxazole-2-carboxylate (PubChem CID 101230856) has the molecular formula C16H19NO5 and a molecular weight of 305.33 g/mol. Its IUPAC name is ethyl 3-oxo-7a-phenylmethoxy-6,7-dihydro-5H-pyrrolo[2,1-b][1,3]oxazole-2-carboxylate.
| Compound Name | ethyl 3-oxo-7a-phenylmethoxy-6,7-dihydro-5H-pyrrolo[2,1-b][1,3]oxazole-2-carboxylate |
|---|---|
| PubChem CID | 101230856 |
| Molecular Formula | C16H19NO5 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | ethyl 3-oxo-7a-phenylmethoxy-6,7-dihydro-5H-pyrrolo[2,1-b][1,3]oxazole-2-carboxylate |
| SMILES | CCOC(=O)C1OC2(OCc3ccccc3)CCCN2C1=O |
| InChI | InChI=1S/C16H19NO5/c1-2-20-15(19)13-14(18)17-10-6-9-16(17,22-13)21-11-12-7-4-3-5-8-12/h3-5,7-8,13H,2,6,9-11H2,1H3 |
| InChIKey | YGYRWHCAVRTNCF-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|