C15H20ClNO3 — CID 70449395
ethyl 1-benzyl-2-oxopiperidine-3-carboxylate;hydrochloride (PubChem CID 70449395) has the molecular formula C15H20ClNO3 and a molecular weight of 297.78 g/mol. Its IUPAC name is ethyl 1-benzyl-2-oxopiperidine-3-carboxylate;hydrochloride.
| Compound Name | ethyl 1-benzyl-2-oxopiperidine-3-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 70449395 |
| Molecular Formula | C15H20ClNO3 |
| Molecular Weight | 297.78 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | ethyl 1-benzyl-2-oxopiperidine-3-carboxylate;hydrochloride |
| SMILES | CCOC(=O)C1CCCN(Cc2ccccc2)C1=O.Cl |
| InChI | InChI=1S/C15H19NO3.ClH/c1-2-19-15(18)13-9-6-10-16(14(13)17)11-12-7-4-3-5-8-12;/h3-5,7-8,13H,2,6,9-11H2,1H3;1H |
| InChIKey | ORGPYBNVGUGFQL-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.78 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|