C19H25NO3 — CID 101373236
ethyl 1-benzyl-3-cyclohexyl-4-oxoazetidine-2-carboxylate (PubChem CID 101373236) has the molecular formula C19H25NO3 and a molecular weight of 315.41 g/mol. Its IUPAC name is ethyl 1-benzyl-3-cyclohexyl-4-oxoazetidine-2-carboxylate.
| Compound Name | ethyl 1-benzyl-3-cyclohexyl-4-oxoazetidine-2-carboxylate |
|---|---|
| PubChem CID | 101373236 |
| Molecular Formula | C19H25NO3 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | ethyl 1-benzyl-3-cyclohexyl-4-oxoazetidine-2-carboxylate |
| SMILES | CCOC(=O)C1C(C2CCCCC2)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C19H25NO3/c1-2-23-19(22)17-16(15-11-7-4-8-12-15)18(21)20(17)13-14-9-5-3-6-10-14/h3,5-6,9-10,15-17H,2,4,7-8,11-13H2,1H3 |
| InChIKey | CTPHVECRZUDEKX-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |