C15H19NO4 — CID 11780817
ethyl (2R,3S)-1-benzyl-3-hydroxy-6-oxopiperidine-2-carboxylate (PubChem CID 11780817) has the molecular formula C15H19NO4 and a molecular weight of 277.32 g/mol. Its IUPAC name is ethyl (2R,3S)-1-benzyl-3-hydroxy-6-oxopiperidine-2-carboxylate.
| Compound Name | ethyl (2R,3S)-1-benzyl-3-hydroxy-6-oxopiperidine-2-carboxylate |
|---|---|
| PubChem CID | 11780817 |
| Molecular Formula | C15H19NO4 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | ethyl (2R,3S)-1-benzyl-3-hydroxy-6-oxopiperidine-2-carboxylate |
| SMILES | CCOC(=O)[C@H]1[C@@H](O)CCC(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C15H19NO4/c1-2-20-15(19)14-12(17)8-9-13(18)16(14)10-11-6-4-3-5-7-11/h3-7,12,14,17H,2,8-10H2,1H3/t12-,14+/m0/s1 |
| InChIKey | LNJOEUQUUIYICJ-GXTWGEPZSA-N |
| XLogP | 1.10 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |