C17H23NO4 — CID 102264565
ethyl (3R,4R,5S)-1-benzyl-5-ethyl-4-hydroxy-2-oxopiperidine-3-carboxylate (PubChem CID 102264565) has the molecular formula C17H23NO4 and a molecular weight of 305.37 g/mol. Its IUPAC name is ethyl (3R,4R,5S)-1-benzyl-5-ethyl-4-hydroxy-2-oxopiperidine-3-carboxylate.
| Compound Name | ethyl (3R,4R,5S)-1-benzyl-5-ethyl-4-hydroxy-2-oxopiperidine-3-carboxylate |
|---|---|
| PubChem CID | 102264565 |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | ethyl (3R,4R,5S)-1-benzyl-5-ethyl-4-hydroxy-2-oxopiperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1C(=O)N(Cc2ccccc2)C[C@H](CC)[C@H]1O |
| InChI | InChI=1S/C17H23NO4/c1-3-13-11-18(10-12-8-6-5-7-9-12)16(20)14(15(13)19)17(21)22-4-2/h5-9,13-15,19H,3-4,10-11H2,1-2H3/t13-,14+,15+/m0/s1 |
| InChIKey | UZNOISWETOGJRA-RRFJBIMHSA-N |
| XLogP | 1.60 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|