C23H22FNO5 — CID 132537026
ethyl (3aS,4R,7S,7aS)-2-benzyl-4-(4-fluorophenyl)-1,6-dioxo-3a,4,7,7a-tetrahydro-3H-pyrano[3,4-c]pyrrole-7-carboxylate (PubChem CID 132537026) has the molecular formula C23H22FNO5 and a molecular weight of 411.43 g/mol. Its IUPAC name is ethyl (3aS,4R,7S,7aS)-2-benzyl-4-(4-fluorophenyl)-1,6-dioxo-3a,4,7,7a-tetrahydro-3H-pyrano[3,4-c]pyrrole-7-carboxylate.
| Compound Name | ethyl (3aS,4R,7S,7aS)-2-benzyl-4-(4-fluorophenyl)-1,6-dioxo-3a,4,7,7a-tetrahydro-3H-pyrano[3,4-c]pyrrole-7-carboxylate |
|---|---|
| PubChem CID | 132537026 |
| Molecular Formula | C23H22FNO5 |
| Molecular Weight | 411.43 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | ethyl (3aS,4R,7S,7aS)-2-benzyl-4-(4-fluorophenyl)-1,6-dioxo-3a,4,7,7a-tetrahydro-3H-pyrano[3,4-c]pyrrole-7-carboxylate |
| SMILES | CCOC(=O)[C@H]1C(=O)O[C@@H](c2ccc(F)cc2)[C@@H]2CN(Cc3ccccc3)C(=O)[C@H]12 |
| InChI | InChI=1S/C23H22FNO5/c1-2-29-22(27)19-18-17(13-25(21(18)26)12-14-6-4-3-5-7-14)20(30-23(19)28)15-8-10-16(24)11-9-15/h3-11,17-20H,2,12-13H2,1H3/t17-,18+,19+,20+/m1/s1 |
| InChIKey | CJUKRFAKWDZFOF-FYQPLNBISA-N |
| XLogP | 2.88 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.43 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|