C15H17NO3 — CID 10682701
methyl (3S,4S)-1-benzyl-4-ethenyl-2-oxopyrrolidine-3-carboxylate (PubChem CID 10682701) has the molecular formula C15H17NO3 and a molecular weight of 259.30 g/mol. Its IUPAC name is methyl (3S,4S)-1-benzyl-4-ethenyl-2-oxopyrrolidine-3-carboxylate.
| Compound Name | methyl (3S,4S)-1-benzyl-4-ethenyl-2-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 10682701 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | methyl (3S,4S)-1-benzyl-4-ethenyl-2-oxopyrrolidine-3-carboxylate |
| SMILES | C=C[C@@H]1CN(Cc2ccccc2)C(=O)[C@H]1C(=O)OC |
| InChI | InChI=1S/C15H17NO3/c1-3-12-10-16(9-11-7-5-4-6-8-11)14(17)13(12)15(18)19-2/h3-8,12-13H,1,9-10H2,2H3/t12-,13+/m1/s1 |
| InChIKey | GHCTYWLDJLAODO-OLZOCXBDSA-N |
| XLogP | 1.62 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|