C16H19NO3S — CID 100975932
methyl 4-ethenyl-1-[(4-methoxyphenyl)methyl]-2-sulfanylidenepyrrolidine-3-carboxylate (PubChem CID 100975932) has the molecular formula C16H19NO3S and a molecular weight of 305.40 g/mol. Its IUPAC name is methyl 4-ethenyl-1-[(4-methoxyphenyl)methyl]-2-sulfanylidenepyrrolidine-3-carboxylate.
| Compound Name | methyl 4-ethenyl-1-[(4-methoxyphenyl)methyl]-2-sulfanylidenepyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 100975932 |
| Molecular Formula | C16H19NO3S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | methyl 4-ethenyl-1-[(4-methoxyphenyl)methyl]-2-sulfanylidenepyrrolidine-3-carboxylate |
| SMILES | C=CC1CN(Cc2ccc(OC)cc2)C(=S)C1C(=O)OC |
| InChI | InChI=1S/C16H19NO3S/c1-4-12-10-17(15(21)14(12)16(18)20-3)9-11-5-7-13(19-2)8-6-11/h4-8,12,14H,1,9-10H2,2-3H3 |
| InChIKey | JRIKMBPMHKRAGK-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|