C19H19NO3S — CID 10854724
(3S,4R)-3-(benzenesulfonyl)-1-benzyl-4-ethenylpyrrolidin-2-one (PubChem CID 10854724) has the molecular formula C19H19NO3S and a molecular weight of 341.43 g/mol. Its IUPAC name is (3S,4R)-3-(benzenesulfonyl)-1-benzyl-4-ethenylpyrrolidin-2-one.
| Compound Name | (3S,4R)-3-(benzenesulfonyl)-1-benzyl-4-ethenylpyrrolidin-2-one |
|---|---|
| PubChem CID | 10854724 |
| Molecular Formula | C19H19NO3S |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | (3S,4R)-3-(benzenesulfonyl)-1-benzyl-4-ethenylpyrrolidin-2-one |
| SMILES | C=C[C@@H]1CN(Cc2ccccc2)C(=O)[C@H]1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C19H19NO3S/c1-2-16-14-20(13-15-9-5-3-6-10-15)19(21)18(16)24(22,23)17-11-7-4-8-12-17/h2-12,16,18H,1,13-14H2/t16-,18+/m1/s1 |
| InChIKey | QGBWRGZHRUKJLY-AEFFLSMTSA-N |
| XLogP | 2.67 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|