C12H13Cl2NO — CID 101020826
(3S,4S)-1-benzyl-3-chloro-4-(chloromethyl)pyrrolidin-2-one (PubChem CID 101020826) has the molecular formula C12H13Cl2NO and a molecular weight of 258.15 g/mol. Its IUPAC name is (3S,4S)-1-benzyl-3-chloro-4-(chloromethyl)pyrrolidin-2-one.
| Compound Name | (3S,4S)-1-benzyl-3-chloro-4-(chloromethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 101020826 |
| Molecular Formula | C12H13Cl2NO |
| Molecular Weight | 258.15 g/mol |
| Exact Mass | 257.04 |
| IUPAC Name | (3S,4S)-1-benzyl-3-chloro-4-(chloromethyl)pyrrolidin-2-one |
| SMILES | O=C1[C@@H](Cl)[C@H](CCl)CN1Cc1ccccc1 |
| InChI | InChI=1S/C12H13Cl2NO/c13-6-10-8-15(12(16)11(10)14)7-9-4-2-1-3-5-9/h1-5,10-11H,6-8H2/t10-,11+/m1/s1 |
| InChIKey | FEOZBZXSEJHJJL-MNOVXSKESA-N |
| XLogP | 2.49 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.15 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|