C11H11ClN2O2 — CID 78209180
1-benzyl-5-chloro-1,3-diazinane-2,4-dione (PubChem CID 78209180) has the molecular formula C11H11ClN2O2 and a molecular weight of 238.67 g/mol. Its IUPAC name is 1-benzyl-5-chloro-1,3-diazinane-2,4-dione.
| Compound Name | 1-benzyl-5-chloro-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 78209180 |
| Molecular Formula | C11H11ClN2O2 |
| Molecular Weight | 238.67 g/mol |
| Exact Mass | 238.05 |
| IUPAC Name | 1-benzyl-5-chloro-1,3-diazinane-2,4-dione |
| SMILES | O=C1NC(=O)N(Cc2ccccc2)CC1Cl |
| InChI | InChI=1S/C11H11ClN2O2/c12-9-7-14(11(16)13-10(9)15)6-8-4-2-1-3-5-8/h1-5,9H,6-7H2,(H,13,15,16) |
| InChIKey | OKXDPACEQHTLKX-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.67 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|